CAS 885278-56-8

Methyl 7-chloro-1H-indazole-3-carboxylate

Description:

Methyl 7-chloro-1H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 7-position contributes to its reactivity and potential biological activity. The carboxylate functional group at the 3-position, along with the methyl ester, enhances its solubility and reactivity, making it useful in various chemical reactions and applications. This compound is often studied for its potential pharmacological properties, including anti-inflammatory and anticancer activities. Its molecular structure allows for interactions with biological targets, which is of interest in medicinal chemistry. Additionally, the compound's stability and solubility in organic solvents make it suitable for synthetic applications in research and development. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula: C₉H₇ClN₂O₂

InChI: InChI=1S/C9H7ClN2O2/c1-14-9(13)8-5-3-2-4-6(10)7(5)11-12-8/h2-4H,1H3,(H,11,12)

InChI key: InChIKey=FTEOJVVWCZGELM-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=2C(NN1)=C(Cl)C=CC2

Synonyms:

• 1H-Indazole-3-carboxylic acid, 7-chloro-, methyl ester
• Methyl 7-chloro-1H-indazole-3-carboxylate

Methyl 7-chloro-1H-indazole-3-carboxylate

CAS: 885278-56-8

Formula: C₉H₇ClN₂O₂

Purity: %

Color and Shape: Solid

Molecular weight: 210.6171

Ref: IN-DA0045FA

Methyl 7-chloro-1H-indazole-3-carboxylate

CAS: 885278-56-8

Methyl 7-chloro-1H-indazole-3-carboxylate

Purity: 95%

Molecular weight: 210.62g/mol

Ref: 54-OR1064735