CAS 885278-60-4

Ethyl 2-[3-(phenylmethoxy)phenyl]-4-thiazolecarboxylate

Description:

Ethyl 2-[3-(phenylmethoxy)phenyl]-4-thiazolecarboxylate is a chemical compound characterized by its thiazole and ester functional groups. The thiazole ring contributes to its heterocyclic nature, which often imparts unique reactivity and biological activity. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The phenylmethoxy substituent adds to its structural complexity and may influence its interaction with biological targets, potentially exhibiting pharmacological properties. This compound is typically synthesized through multi-step organic reactions, involving the formation of the thiazole ring and subsequent esterification. Its molecular structure suggests potential applications in drug development, particularly in areas related to anti-inflammatory or anticancer activities, although specific biological activities would require empirical investigation. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₉H₁₇NO₃S

InChI: InChI=1S/C19H17NO3S/c1-2-22-19(21)17-13-24-18(20-17)15-9-6-10-16(11-15)23-12-14-7-4-3-5-8-14/h3-11,13H,2,12H2,1H3

InChI key: InChIKey=SSXQYAVTKXTMJY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N=C(SC1)C2=CC(OCC3=CC=CC=C3)=CC=C2

Synonyms:

• 2-(3-Benzyloxy-Phenyl)-Thiazole-4-Carboxylic Acid Ethyl Ester
• 4-Thiazolecarboxylic acid, 2-[3-(phenylmethoxy)phenyl]-, ethyl ester
• Ethyl 2-[3-(phenylmethoxy)phenyl]-4-thiazolecarboxylate

Ethyl 2-(3-(benzyloxy)phenyl)thiazole-4-carboxylate

CAS: 885278-60-4

Formula: C₁₉H₁₇NO₃S

Molecular weight: 339.4082

Ref: IN-DA0089AL