CAS 885278-62-6
:methyl 5-benzyloxy-1H-indazole-3-carboxylate
Description:
Methyl 5-benzyloxy-1H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a carboxylate ester functional group, contributing to its reactivity and solubility properties. The presence of the benzyloxy group enhances its lipophilicity, potentially influencing its biological activity and interactions. The methyl ester group can participate in various chemical reactions, such as hydrolysis or transesterification, making it versatile in synthetic applications. Additionally, the indazole structure is known for its pharmacological significance, often being explored for its potential therapeutic effects. The compound's molecular structure suggests it may exhibit interesting properties, including fluorescence or specific binding affinities, depending on its environment. Overall, methyl 5-benzyloxy-1H-indazole-3-carboxylate is a compound of interest in both synthetic organic chemistry and medicinal chemistry, warranting further investigation into its applications and effects.
Formula:C16H14N2O3
InChI:InChI=1/C16H14N2O3/c1-20-16(19)15-13-9-12(7-8-14(13)17-18-15)21-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,17,18)
SMILES:COC(=O)c1c2cc(ccc2[nH]n1)OCc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
