
CAS 885278-68-2
:4-(2-Aminoethyl)-N,N-dimethylbenzamide
Description:
4-(2-Aminoethyl)-N,N-dimethylbenzamide, identified by its CAS number 885278-68-2, is an organic compound characterized by its amide functional group and a benzene ring substituted with a dimethylamino group and an aminoethyl chain. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents due to the presence of the amine and amide functionalities. It may display basic characteristics owing to the amino group, which can accept protons. The presence of the dimethylamino group contributes to its overall lipophilicity, potentially influencing its biological activity and interactions. The compound's structure suggests it may participate in hydrogen bonding, which can affect its melting and boiling points, as well as its reactivity in various chemical environments. Additionally, due to its functional groups, it may have applications in pharmaceuticals or as a building block in organic synthesis. However, specific reactivity and stability would depend on the conditions under which it is used.
Formula:C11H16N2O
InChI:InChI=1S/C11H16N2O/c1-13(2)11(14)10-5-3-9(4-6-10)7-8-12/h3-6H,7-8,12H2,1-2H3
InChI key:InChIKey=WYFJCBPXSNDWLD-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C1=CC=C(CCN)C=C1
Synonyms:- 4-(2-Aminoethyl)-N,N-dimethylbenzamide
- Benzamide, 4-(2-aminoethyl)-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.