CAS 885278-77-3
:4-benzyloxyindoline
Description:
4-Benzyloxyindoline is an organic compound characterized by its indoline structure, which is a bicyclic compound consisting of a fused benzene and pyrrole ring. The presence of a benzyloxy group at the 4-position of the indoline ring significantly influences its chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents, and its structure allows for potential interactions in various chemical environments. 4-Benzyloxyindoline may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the presence of both the indoline and benzyloxy functionalities. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The compound's molecular structure can be analyzed using techniques such as NMR spectroscopy and mass spectrometry, which provide insights into its purity and identity. Overall, 4-benzyloxyindoline serves as a valuable building block in organic synthesis and pharmaceutical research.
Formula:C15H15NO
InChI:InChI=1/C15H15NO/c1-2-5-12(6-3-1)11-17-15-8-4-7-14-13(15)9-10-16-14/h1-8,16H,9-11H2
SMILES:c1ccc(cc1)COc1cccc2c1CCN2
Synonyms:- 4-(Benzyloxy)indoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
