CAS 885278-90-0
:2-(3-Methyl-4-nitrophenyl)-4-thiazolecarboxaldehyde
Description:
2-(3-Methyl-4-nitrophenyl)-4-thiazolecarboxaldehyde is an organic compound characterized by its thiazole and aldehyde functional groups. The thiazole ring contributes to its heterocyclic nature, while the aldehyde group is indicative of its reactivity, particularly in condensation reactions. The presence of a nitro group and a methyl group on the phenyl ring influences its electronic properties, potentially enhancing its reactivity and solubility in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of more complex molecules. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in any practical applications. Overall, 2-(3-Methyl-4-nitrophenyl)-4-thiazolecarboxaldehyde is a versatile compound with potential utility in various chemical and biological contexts.
Formula:C11H8N2O3S
InChI:InChI=1S/C11H8N2O3S/c1-7-4-8(2-3-10(7)13(15)16)11-12-9(5-14)6-17-11/h2-6H,1H3
InChI key:InChIKey=SYCKURTXMKRUTR-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1N(=O)=O)C2=NC(C=O)=CS2
Synonyms:- 2-(3-Methyl-4-Nitro-Phenyl)-Thiazole-4-Carbaldehyde
- 2-(3-Methyl-4-nitrophenyl)-4-thiazolecarboxaldehyde
- 4-Thiazolecarboxaldehyde, 2-(3-methyl-4-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
