CAS 885278-93-3
:2-[4-(Phenylmethoxy)phenyl]-4-thiazolecarboxaldehyde
Description:
2-[4-(Phenylmethoxy)phenyl]-4-thiazolecarboxaldehyde is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of the phenylmethoxy group suggests that it has significant aromatic character, contributing to its stability and potential interactions in various chemical environments. The compound's structure allows for various functionalization possibilities, making it of interest in medicinal chemistry and material science. Its CAS number, 885278-93-3, provides a unique identifier for regulatory and research purposes. As with many thiazole derivatives, it may exhibit biological activity, which could be explored for pharmaceutical applications. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research and development in various chemical fields.
Formula:C17H13NO2S
InChI:InChI=1S/C17H13NO2S/c19-10-15-12-21-17(18-15)14-6-8-16(9-7-14)20-11-13-4-2-1-3-5-13/h1-10,12H,11H2
InChI key:InChIKey=SUGYRLHBOMEIKR-UHFFFAOYSA-N
SMILES:C(=O)C=1N=C(SC1)C2=CC=C(OCC3=CC=CC=C3)C=C2
Synonyms:- 2-(4-Benzyloxy-Phenyl)-Thiazole-4-Carbaldehyde
- 2-[4-(Phenylmethoxy)phenyl]-4-thiazolecarboxaldehyde
- 4-Thiazolecarboxaldehyde, 2-[4-(phenylmethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
