CAS 885278-95-5

Methyl 7-methoxy-1H-indazole-3-carboxylate

Description:

Methyl 7-methoxy-1H-indazole-3-carboxylate, identified by its CAS number 885278-95-5, is a chemical compound that belongs to the indazole class of compounds. It features a methoxy group and a carboxylate ester functional group, contributing to its chemical reactivity and potential applications. The indazole core structure is characterized by a fused five-membered and six-membered ring system, which imparts unique electronic properties and biological activity. This compound is typically used in medicinal chemistry and research, particularly in the development of pharmaceuticals due to its potential biological activities, including anti-inflammatory and anticancer properties. Its solubility and stability can vary based on the solvent and environmental conditions, making it important to consider these factors in practical applications. As with many organic compounds, safety data should be reviewed to ensure proper handling and usage in laboratory settings. Overall, Methyl 7-methoxy-1H-indazole-3-carboxylate represents a valuable compound for further exploration in chemical and biological research.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1S/C10H10N2O3/c1-14-7-5-3-4-6-8(7)11-12-9(6)10(13)15-2/h3-5H,1-2H3,(H,11,12)

InChI key: InChIKey=QHDUJTCUPWHNPK-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=2C(=C(OC)C=CC2)NN1

Synonyms:

• 1H-Indazole-3-carboxylic acid, 7-methoxy-, methyl ester
• Methyl 7-Methoxy-1H-Indazole-3-Carboxylate

Methyl 7-Methoxy-2H-indazole-3-carboxylate

Controlled Product

CAS: 885278-95-5

Formula: C₁₀H₁₀N₂O₃

Color and Shape: Neat

Molecular weight: 206.198

Ref: TR-M320310