CAS 885279-08-3
:2-(3-Ethylphenyl)-4-thiazolecarboxaldehyde
Description:
2-(3-Ethylphenyl)-4-thiazolecarboxaldehyde is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an aldehyde functional group (-CHO) attached to a thiazole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethylphenyl substituent enhances its hydrophobic character, which may influence its solubility and interaction with biological systems. Typically, compounds like this can exhibit various biological activities, making them of interest in medicinal chemistry. The thiazole moiety is known for its role in pharmaceuticals, often associated with antimicrobial and anti-inflammatory properties. Additionally, the compound's structure suggests potential for further derivatization, allowing for the exploration of its chemical reactivity and the development of new derivatives with tailored properties. Overall, 2-(3-Ethylphenyl)-4-thiazolecarboxaldehyde represents a versatile scaffold in organic chemistry with implications in drug discovery and material science.
Formula:C12H11NOS
InChI:InChI=1S/C12H11NOS/c1-2-9-4-3-5-10(6-9)12-13-11(7-14)8-15-12/h3-8H,2H2,1H3
InChI key:InChIKey=OSCBSOZMXHNLDB-UHFFFAOYSA-N
SMILES:C(=O)C=1N=C(SC1)C2=CC(CC)=CC=C2
Synonyms:- 2-(3-Ethyl-Phenyl)-Thiazole-4-Carbaldehyde
- 2-(3-Ethylphenyl)-4-thiazolecarboxaldehyde
- 4-Thiazolecarboxaldehyde, 2-(3-ethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
