CAS 885279-13-0
:5-(Trifluoromethoxy)benzo[b]thiophene-2-carboxylic acid
Description:
5-(Trifluoromethoxy)benzo[b]thiophene-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with a trifluoromethoxy group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential stability and reactivity due to the presence of the electron-withdrawing trifluoromethoxy group. The carboxylic acid moiety contributes to its acidity and potential for hydrogen bonding, which can influence its solubility and interactions in various solvents. The trifluoromethoxy group enhances the compound's lipophilicity and may impart unique electronic properties, making it of interest in medicinal chemistry and materials science. Additionally, the presence of fluorine atoms can affect the compound's biological activity and pharmacokinetics. Overall, this compound's distinctive features make it a subject of interest for further research in various chemical applications, including drug development and synthesis of novel materials.
Formula:C10H5F3O3S
InChI:InChI=1S/C10H5F3O3S/c11-10(12,13)16-6-1-2-7-5(3-6)4-8(17-7)9(14)15/h1-4H,(H,14,15)
InChI key:InChIKey=XKONKDCQIVYHGO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(S1)=CC=C(OC(F)(F)F)C2
Synonyms:- 5-Trifluoromethoxy-Benzo[B]Thiophene-2-Carboxylic Acid
- 5-Trifluoromethoxybenzo[b]thiophene-2-carboxylic acid
- Benzo[b]thiophene-2-carboxylic acid, 5-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-(Trifluoromethoxy)benzo[b]thiophene-2-carboxylic acid
CAS:Formula:C10H5F3O3SMolecular weight:262.20515-(Trifluoromethoxy)-1-benzothiophene-2-carboxylic acid
CAS:<p>5-(Trifluoromethoxy)-1-benzothiophene-2-carboxylic acid</p>Molecular weight:262.20511g/mol


