CAS 885279-14-1
:2-(2-bromophenyl)thiazole-4-carbaldehyde
Description:
2-(2-Bromophenyl)thiazole-4-carbaldehyde is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a bromophenyl group indicates that a bromine atom is substituted on a phenyl ring, contributing to the compound's reactivity and potential applications in various chemical reactions. The aldehyde functional group (-CHO) at the 4-position of the thiazole ring is significant for its reactivity, particularly in condensation reactions and as a precursor in organic synthesis. This compound may exhibit properties such as fluorescence or biological activity, making it of interest in medicinal chemistry and materials science. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and stability in different solvents. Overall, 2-(2-bromophenyl)thiazole-4-carbaldehyde is a versatile compound with potential applications in pharmaceuticals and agrochemicals.
Formula:C10H6BrNOS
InChI:InChI=1/C10H6BrNOS/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-6H
SMILES:c1ccc(c(c1)c1nc(C=O)cs1)Br
Synonyms:- 2-(2-Bromophenyl)-1,3-thiazole-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
