CAS 885279-16-3
:Methyl 5-(trifluoromethoxy)benzo[b]thiophene-2-carboxylate
Description:
Methyl 5-(trifluoromethoxy)benzo[b]thiophene-2-carboxylate is a chemical compound characterized by its unique structure, which includes a thiophene ring fused to a benzene ring, along with a carboxylate ester functional group and a trifluoromethoxy substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of electron-withdrawing trifluoromethoxy groups. The trifluoromethoxy group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the carboxylate group can facilitate various chemical reactions, including esterification and nucleophilic substitutions. Methyl 5-(trifluoromethoxy)benzo[b]thiophene-2-carboxylate may also exhibit interesting optical properties, which can be explored in applications such as organic electronics or as a precursor in the synthesis of more complex molecules. Overall, its unique structural features and functional groups contribute to its potential utility in various chemical and pharmaceutical applications.
Formula:C11H7F3O3S
InChI:InChI=1S/C11H7F3O3S/c1-16-10(15)9-5-6-4-7(17-11(12,13)14)2-3-8(6)18-9/h2-5H,1H3
InChI key:InChIKey=SBWDLPVAPIPKRG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1SC=2C(C1)=CC(OC(F)(F)F)=CC2
Synonyms:- 5-Trifluoromethoxybenzo[b]thiophene-2-carboxylic acid methyl ester
- Methyl 5-(trifluoromethoxy)benzo[b]thiophene-2-carboxylate
- Benzo[b]thiophene-2-carboxylic acid, 5-(trifluoromethoxy)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Methyl 5-(trifluoromethoxy)benzo[b]thiophene-2-carboxylate
CAS:Formula:C11H7F3O3SMolecular weight:276.2317Methyl 5-(trifluoromethoxy)-1-benzothiophene-2-carboxylate
CAS:<p>Methyl 5-(trifluoromethoxy)-1-benzothiophene-2-carboxylate</p>Molecular weight:276.23169g/mol


