CAS 885279-27-6
:2-(4-Ethylphenyl)-4-thiazolecarboxaldehyde
Description:
2-(4-Ethylphenyl)-4-thiazolecarboxaldehyde is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an aldehyde functional group (-CHO) attached to a thiazole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethylphenyl group enhances its hydrophobic characteristics, which may influence its solubility in various organic solvents. The compound is likely to exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules, as well as in the development of agrochemicals or pharmaceuticals. Additionally, the thiazole moiety is known for its role in various biological activities, including antimicrobial and antifungal properties. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H11NOS
InChI:InChI=1S/C12H11NOS/c1-2-9-3-5-10(6-4-9)12-13-11(7-14)8-15-12/h3-8H,2H2,1H3
InChI key:InChIKey=WNPXTBVDXBOLND-UHFFFAOYSA-N
SMILES:C(=O)C=1N=C(SC1)C2=CC=C(CC)C=C2
Synonyms:- 2-(4-Ethyl-Phenyl)-Thiazole-4-Carbaldehyde
- 2-(4-Ethylphenyl)-4-thiazolecarboxaldehyde
- 4-Thiazolecarboxaldehyde, 2-(4-ethylphenyl)-
- 2-(4-ethylphenyl)-1,3-thiazole-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
