CymitQuimica logo

CAS 885279-30-1

:

ethyl 6-fluoro-1H-indazole-3-carboxylate

Description:
Ethyl 6-fluoro-1H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a fluoro group at the 6-position enhances its reactivity and may influence its biological activity. The ethyl ester functional group at the 3-position contributes to its solubility and stability, making it suitable for various applications in medicinal chemistry and drug development. This compound is typically synthesized through specific reactions involving indazole derivatives and fluorinating agents. Its unique structure allows for potential interactions with biological targets, making it of interest in pharmaceutical research. Additionally, the compound's properties, such as melting point, solubility, and spectral characteristics, can vary based on the conditions of synthesis and purification. As with many fluorinated compounds, ethyl 6-fluoro-1H-indazole-3-carboxylate may exhibit enhanced metabolic stability and bioavailability, which are desirable traits in drug design.
Formula:C10H9FN2O2
InChI:InChI=1/C10H9FN2O2/c1-2-15-10(14)9-7-4-3-6(11)5-8(7)12-13-9/h3-5H,2H2,1H3,(H,12,13)
SMILES:CCOC(=O)c1c2ccc(cc2[nH]n1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.