CymitQuimica logo

CAS 885279-45-8

:

Ethyl 1H-indazole-4-carboxylate

Description:
Ethyl 1H-indazole-4-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an ethyl ester functional group at the carboxylic acid position, contributing to its solubility and reactivity. Ethyl 1H-indazole-4-carboxylate is typically a white to off-white solid, and it is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its bioactive properties. The compound may exhibit various biological activities, including anti-inflammatory and anticancer effects, making it of interest in drug discovery. Its molecular structure allows for various synthetic modifications, which can enhance its pharmacological profile. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c1-2-14-10(13)7-4-3-5-9-8(7)6-11-12-9/h3-6H,2H2,1H3,(H,11,12)
InChI key:InChIKey=ZYDRWPMGDIWCRN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2C(=CC=C1)NN=C2
Synonyms:
  • 1H-Indazole-4-carboxylic acid, ethyl ester
  • Ethyl 1H-indazole-4-carboxylate
Found 4 products.