CymitQuimica logo

CAS 885279-57-2

:

2-(4-Bromophenyl)-4,5,6,7-tetrahydrothiazolo[4,5-c]pyridine

Description:
2-(4-Bromophenyl)-4,5,6,7-tetrahydrothiazolo[4,5-c]pyridine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a thiazole and a pyridine moiety. The presence of the bromophenyl group enhances its lipophilicity and may influence its biological activity. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents and potential reactivity due to the presence of nitrogen and sulfur atoms in its structure. It may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, owing to the functional groups present. Additionally, compounds of this class are often investigated for their pharmacological properties, including potential applications in medicinal chemistry, where they may exhibit activity against specific biological targets. The molecular structure contributes to its potential interactions with biological systems, making it a subject of interest in drug discovery and development. Overall, 2-(4-Bromophenyl)-4,5,6,7-tetrahydrothiazolo[4,5-c]pyridine represents a complex and intriguing compound within the realm of organic chemistry.
Formula:C12H11BrN2S
InChI:InChI=1S/C12H11BrN2S/c13-9-3-1-8(2-4-9)12-15-10-7-14-6-5-11(10)16-12/h1-4,14H,5-7H2
InChI key:InChIKey=GYDIFSJFYJOBQW-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C2=NC3=C(S2)CCNC3)C=C1
Synonyms:
  • 2-(4-Bromophenyl)-4,5,6,7-tetrahydrothiazolo[4,5-c]pyridine
  • Thiazolo[4,5-c]pyridine, 2-(4-bromophenyl)-4,5,6,7-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.