CymitQuimica logo

CAS 885279-61-8

:

2-(4-Bromophenyl)-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine

Description:
2-(4-Bromophenyl)-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine is a heterocyclic compound characterized by its unique thiazolo and pyridine ring structures. This compound features a bromophenyl substituent, which enhances its potential for biological activity and reactivity due to the presence of the bromine atom, known for its electronegative properties. The tetrahydrothiazolo moiety contributes to the compound's structural complexity and may influence its solubility and interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry. The presence of multiple rings and functional groups often leads to interesting electronic properties and reactivity patterns, making them suitable candidates for drug development. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be essential for understanding its behavior in various chemical environments. Overall, 2-(4-Bromophenyl)-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine represents a class of compounds with significant potential in research and application within the fields of organic and medicinal chemistry.
Formula:C12H11BrN2S
InChI:InChI=1S/C12H11BrN2S/c13-9-3-1-8(2-4-9)12-15-10-5-6-14-7-11(10)16-12/h1-4,14H,5-7H2
InChI key:InChIKey=DJBBHLWKRYLCTG-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C2=NC3=C(S2)CNCC3)C=C1
Synonyms:
  • Thiazolo[5,4-c]pyridine, 2-(4-bromophenyl)-4,5,6,7-tetrahydro-
  • 2-(4-Bromophenyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine
  • 2-(4-Bromophenyl)-4H,5H,6H,7H-[1,3]thiazolo[5,4-c]pyridine
  • 2-(4-Bromophenyl)-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.