CAS 885279-67-4
:1-(2-Bromo-1-phenylethyl)-2-chlorobenzene
Description:
1-(2-Bromo-1-phenylethyl)-2-chlorobenzene, with the CAS number 885279-67-4, is an organic compound characterized by its aromatic structure and the presence of both bromine and chlorine substituents. This compound features a phenylethyl group attached to a chlorobenzene ring, where the bromine atom is located on the ethyl side chain. The presence of these halogen atoms contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic nature, which can influence its solubility in organic solvents. Additionally, the steric and electronic effects of the bromine and chlorine substituents may impact its chemical behavior, including its reactivity and stability under different conditions. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C14H12BrCl
InChI:InChI=1S/C14H12BrCl/c15-10-13(11-6-2-1-3-7-11)12-8-4-5-9-14(12)16/h1-9,13H,10H2
InChI key:InChIKey=MZYKKUJWLVOMTP-UHFFFAOYSA-N
SMILES:C(CBr)(C1=C(Cl)C=CC=C1)C2=CC=CC=C2
Synonyms:- Benzene, 1-(2-bromo-1-phenylethyl)-2-chloro-
- 1-(2-Bromo-1-phenylethyl)-2-chlorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
