CAS 885279-83-4
:2-(4-Hydroxyphenyl)-4-thiazolemethanol
Description:
2-(4-Hydroxyphenyl)-4-thiazolemethanol, identified by its CAS number 885279-83-4, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound is characterized by the presence of a hydroxyl group (-OH) attached to a phenyl ring, contributing to its potential as a phenolic compound. The thiazole moiety may impart biological activity, making it of interest in medicinal chemistry and pharmacology. The hydroxyl group can enhance solubility in polar solvents and may also participate in hydrogen bonding, influencing the compound's reactivity and interaction with biological targets. Additionally, the structural arrangement suggests potential for various chemical modifications, which could lead to derivatives with altered properties. Overall, 2-(4-Hydroxyphenyl)-4-thiazolemethanol is a compound of interest for research, particularly in the fields of organic synthesis and drug development, due to its unique structural features and potential biological applications.
Formula:C10H9NO2S
InChI:InChI=1S/C10H9NO2S/c12-5-8-6-14-10(11-8)7-1-3-9(13)4-2-7/h1-4,6,12-13H,5H2
InChI key:InChIKey=VZCPHRCBMAEIKY-UHFFFAOYSA-N
SMILES:C(O)C=1N=C(SC1)C2=CC=C(O)C=C2
Synonyms:- 4-Thiazolemethanol, 2-(4-hydroxyphenyl)-
- 2-(4-Hydroxyphenyl)-4-thiazolemethanol
- 4-(4-HYDROXYMETHYL-THIAZOL-2-YL)-PHENOL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
