CymitQuimica logo

CAS 885280-13-7

:

2-(4-Fluorophenyl)-4-thiazolemethanol

Description:
2-(4-Fluorophenyl)-4-thiazolemethanol is a chemical compound characterized by its unique structure, which includes a thiazole ring and a fluorophenyl group. The presence of the thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The fluorine atom in the para position of the phenyl ring can enhance the compound's lipophilicity and influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, would be influenced by the functional groups present, making it a subject of interest for further research in synthetic and medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C10H8FNOS
InChI:InChI=1S/C10H8FNOS/c11-8-3-1-7(2-4-8)10-12-9(5-13)6-14-10/h1-4,6,13H,5H2
InChI key:InChIKey=QTKNJWCGPSLBSS-UHFFFAOYSA-N
SMILES:C(O)C=1N=C(SC1)C2=CC=C(F)C=C2
Synonyms:
  • 2-(4-fluorophenyl)-4-Thiazolemethanol
  • [2-(4-Fluoro-Phenyl)-Thiazol-4-Yl]-Methanol
  • [2-(4-Fluorophenyl)-1,3-thiazol-4-yl]methanol
  • [2-(4-Fluorophenyl)thiazol-4-yl]methanol
  • 4-Thiazolemethanol, 2-(4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.