CymitQuimica logo

CAS 885280-21-7

:

2-(2-Bromophenyl)-4-thiazolemethanamine

Description:
2-(2-Bromophenyl)-4-thiazolemethanamine is a chemical compound characterized by its unique structural features, which include a thiazole ring and a bromophenyl group. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The presence of the bromine atom in the phenyl ring can enhance the compound's lipophilicity and may influence its reactivity and interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for understanding its behavior in different environments and its suitability for various applications. Safety data and handling precautions should be considered due to the presence of bromine, which can pose health risks.
Formula:C10H9BrN2S
InChI:InChI=1S/C10H9BrN2S/c11-9-4-2-1-3-8(9)10-13-7(5-12)6-14-10/h1-4,6H,5,12H2
InChI key:InChIKey=ZZZQAZNPNXHCJN-UHFFFAOYSA-N
SMILES:BrC1=C(C2=NC(CN)=CS2)C=CC=C1
Synonyms:
  • 4-Thiazolemethanamine, 2-(2-bromophenyl)-
  • 2-(2-Bromophenyl)-4-thiazolemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.