CAS 885280-27-3
:4-Thiazolemethanamine, 2-(2-methoxyphenyl)-
Description:
4-Thiazolemethanamine, 2-(2-methoxyphenyl)-, identified by its CAS number 885280-27-3, is a chemical compound characterized by its thiazole and methanamine functional groups. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the thiazole ring, which is known for its role in various pharmacological applications. The methoxyphenyl group contributes to its lipophilicity, potentially enhancing its ability to penetrate biological membranes. In terms of solubility, compounds of this nature may exhibit moderate solubility in organic solvents, while their solubility in water can vary based on the specific substituents and their interactions. The compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Overall, 4-Thiazolemethanamine, 2-(2-methoxyphenyl)- is of interest in medicinal chemistry and may serve as a scaffold for the development of new therapeutic agents.
Formula:C11H12N2OS
InChI:InChI=1S/C11H12N2OS/c1-14-10-5-3-2-4-9(10)11-13-8(6-12)7-15-11/h2-5,7H,6,12H2,1H3
InChI key:InChIKey=KHQIHGXGSYZUBV-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)C2=NC(CN)=CS2
Synonyms:- 4-Thiazolemethanamine, 2-(2-methoxyphenyl)-
- (2-(2-Methoxyphenyl)thiazol-4-yl)methanamine
- 2-(2-Methoxyphenyl)-4-thiazolemethanamine
- [2-(2-Methoxyphenyl)-1,3-thiazol-4-yl]methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
