CAS 885280-31-9
:2-(3-Fluorophenyl)-4-thiazolemethanamine
Description:
2-(3-Fluorophenyl)-4-thiazolemethanamine is a chemical compound characterized by its thiazole ring and an amine functional group. The presence of a fluorophenyl group indicates that it has a fluorine atom substituted on a phenyl ring, which can influence its electronic properties and biological activity. The thiazole moiety contributes to the compound's potential as a pharmacophore, often associated with various biological activities, including antimicrobial and anticancer properties. The amine group can participate in hydrogen bonding, enhancing solubility and reactivity. This compound may be of interest in medicinal chemistry for its potential therapeutic applications, and its unique structure could lead to interactions with biological targets. Additionally, the specific arrangement of atoms and functional groups in 2-(3-Fluorophenyl)-4-thiazolemethanamine may affect its stability, reactivity, and overall behavior in different chemical environments. As with many organic compounds, its properties can be influenced by factors such as pH, solvent, and temperature, making it a subject of interest for further research and development in various fields, including pharmaceuticals and materials science.
Formula:C10H9FN2S
InChI:InChI=1S/C10H9FN2S/c11-8-3-1-2-7(4-8)10-13-9(5-12)6-14-10/h1-4,6H,5,12H2
InChI key:InChIKey=BAFDWACDUQQWDS-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(SC1)C2=CC(F)=CC=C2
Synonyms:- 2-(3-Fluorophenyl)-4-thiazolemethanamine
- C-[2-(3-Fluoro-Phenyl)-Thiazol-4-Yl]-Methylamine
- 4-Thiazolemethanamine, 2-(3-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
[2-(3-Fluorophenyl)-1,3-thiazol-4-yl]methanamine
CAS:[2-(3-Fluorophenyl)-1,3-thiazol-4-yl]methanamine
Molecular weight:208.25526g/mol


