CAS 885280-35-3
:2-(3,4-Dimethylphenyl)-4-thiazolemethanol
Description:
2-(3,4-Dimethylphenyl)-4-thiazolemethanol is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of the 3,4-dimethylphenyl group indicates that the compound has two methyl substituents on the aromatic ring, contributing to its hydrophobic characteristics and potentially influencing its biological activity. The hydroxymethyl group (-CH2OH) attached to the thiazole ring suggests that the compound may exhibit polar characteristics, which can enhance its solubility in polar solvents. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to various pharmacological properties. Additionally, the thiazole moiety is often associated with a range of biological activities, including antimicrobial and anti-inflammatory effects. However, specific data regarding its reactivity, stability, and potential applications would require further investigation through experimental studies and literature reviews.
Formula:C12H13NOS
InChI:InChI=1S/C12H13NOS/c1-8-3-4-10(5-9(8)2)12-13-11(6-14)7-15-12/h3-5,7,14H,6H2,1-2H3
InChI key:InChIKey=JNFXAHGZXZFYHE-UHFFFAOYSA-N
SMILES:C(O)C=1N=C(SC1)C2=CC(C)=C(C)C=C2
Synonyms:- 2-(3,4-Dimethylphenyl)-4-thiazolemethanol
- [2-(3,4-Dimethyl-Phenyl)-Thiazol-4-Yl]-Methanol
- 4-Thiazolemethanol, 2-(3,4-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
