CAS 885280-43-3
:2-(4-Ethylphenyl)-4-thiazolemethanol
Description:
2-(4-Ethylphenyl)-4-thiazolemethanol is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of the ethylphenyl group contributes to its hydrophobic characteristics, while the hydroxymethyl group (-CH2OH) enhances its potential for hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its thiazole moiety is often associated with various pharmacological properties, including antimicrobial and anti-inflammatory effects. The molecular structure suggests potential interactions with biological targets, which could be explored in further research. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings. Overall, 2-(4-Ethylphenyl)-4-thiazolemethanol presents a unique combination of structural features that may lend itself to various applications in chemistry and pharmacology.
Formula:C12H13NOS
InChI:InChI=1S/C12H13NOS/c1-2-9-3-5-10(6-4-9)12-13-11(7-14)8-15-12/h3-6,8,14H,2,7H2,1H3
InChI key:InChIKey=HMKOEXBFDQZHAB-UHFFFAOYSA-N
SMILES:C(O)C=1N=C(SC1)C2=CC=C(CC)C=C2
Synonyms:- 2-(4-Ethylphenyl)-4-thiazolemethanol
- [2-(4-Ethyl-Phenyl)-Thiazol-4-Yl]-Methanol
- 4-Thiazolemethanol, 2-(4-ethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
