CAS 885280-57-9
:2-(3-Bromophenyl)-4-thiazolemethanol
Description:
2-(3-Bromophenyl)-4-thiazolemethanol is a chemical compound characterized by its thiazole ring and a bromophenyl substituent. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The presence of the bromine atom on the phenyl group can enhance the compound's lipophilicity and influence its reactivity, making it a candidate for further chemical modifications. This compound typically exhibits moderate solubility in organic solvents, and its structure may allow for hydrogen bonding due to the hydroxymethyl group, which can affect its interaction with biological targets. The compound's unique features may lead to applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as melting point, boiling point, and spectral data would need to be referenced from experimental sources or databases for precise characterization.
Formula:C10H8BrNOS
InChI:InChI=1S/C10H8BrNOS/c11-8-3-1-2-7(4-8)10-12-9(5-13)6-14-10/h1-4,6,13H,5H2
InChI key:InChIKey=HXKGKOOGVICYBT-UHFFFAOYSA-N
SMILES:C(O)C=1N=C(SC1)C2=CC(Br)=CC=C2
Synonyms:- (2-(3-Bromophenyl)thiazol-4-yl)methanol
- 2-(3-Bromophenyl)-4-thiazolemethanol
- [2-(3-Bromo-Phenyl)-Thiazol-4-Yl]-Methanol
- [2-(3-Bromophenyl)-1,3-thiazol-4-yl]methanol
- 4-Thiazolemethanol, 2-(3-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
