CAS 885280-61-5
:2-(3-Methyl-4-nitrophenyl)-4-thiazolemethanamine
Description:
2-(3-Methyl-4-nitrophenyl)-4-thiazolemethanamine, with the CAS number 885280-61-5, is a chemical compound characterized by its thiazole ring and an amine functional group. This compound features a nitrophenyl moiety, which contributes to its potential reactivity and biological activity. The presence of the methyl and nitro substituents on the phenyl ring can influence its electronic properties, making it a candidate for various applications in medicinal chemistry and material science. Thiazole derivatives are known for their diverse biological activities, including antimicrobial and anticancer properties. The compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which could affect its solubility and stability in different solvents. Additionally, the presence of the amine group may allow for further derivatization, enhancing its utility in synthetic chemistry. Overall, this compound represents a unique structure that could be of interest in research and development within the fields of pharmaceuticals and agrochemicals.
Formula:C11H11N3O2S
InChI:InChI=1S/C11H11N3O2S/c1-7-4-8(2-3-10(7)14(15)16)11-13-9(5-12)6-17-11/h2-4,6H,5,12H2,1H3
InChI key:InChIKey=KXKBIKIKOSCAII-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1N(=O)=O)C2=NC(CN)=CS2
Synonyms:- 4-Thiazolemethanamine, 2-(3-methyl-4-nitrophenyl)-
- 2-(3-Methyl-4-nitrophenyl)-4-thiazolemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
