
CAS 885280-65-9
:2-[4-(Phenylmethoxy)phenyl]-4-thiazolemethanamine
Description:
2-[4-(Phenylmethoxy)phenyl]-4-thiazolemethanamine, identified by its CAS number 885280-65-9, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a phenylmethoxy group, indicating the presence of a phenyl ring bonded to a methoxy group, which enhances its lipophilicity and potential biological activity. The thiazole moiety contributes to its reactivity and may influence its interaction with biological targets. The amine functional group suggests potential for hydrogen bonding, which can be crucial for its solubility and interaction with other molecules. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas targeting specific biological pathways or conditions. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C17H16N2OS
InChI:InChI=1S/C17H16N2OS/c18-10-15-12-21-17(19-15)14-6-8-16(9-7-14)20-11-13-4-2-1-3-5-13/h1-9,12H,10-11,18H2
InChI key:InChIKey=FYGNJYLXDRROPN-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(SC1)C2=CC=C(OCC3=CC=CC=C3)C=C2
Synonyms:- 2-[4-(Phenylmethoxy)phenyl]-4-thiazolemethanamine
- 4-Thiazolemethanamine, 2-[4-(phenylmethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
