CAS 885280-80-8
:2-(4-Ethylphenyl)-4-thiazolemethanamine
Description:
2-(4-Ethylphenyl)-4-thiazolemethanamine, identified by its CAS number 885280-80-8, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound is characterized by the presence of an ethylphenyl group, which contributes to its hydrophobic properties, and an amine functional group that can participate in hydrogen bonding. The thiazole moiety often imparts biological activity, making such compounds of interest in medicinal chemistry. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Additionally, the presence of the thiazole ring may influence its electronic properties, making it a candidate for further studies in organic synthesis and material science. As with any chemical substance, safety data and handling precautions should be reviewed before use in laboratory or industrial settings.
Formula:C12H14N2S
InChI:InChI=1S/C12H14N2S/c1-2-9-3-5-10(6-4-9)12-14-11(7-13)8-15-12/h3-6,8H,2,7,13H2,1H3
InChI key:InChIKey=UHYPUMJGLKYKPK-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(SC1)C2=CC=C(CC)C=C2
Synonyms:- 2-(4-Ethylphenyl)-4-thiazolemethanamine
- 4-Thiazolemethanamine, 2-(4-ethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
