CAS 885280-99-9
:N-Cycloheptyltetrahydro-2H-pyran-4-amine
Description:
N-Cycloheptyltetrahydro-2H-pyran-4-amine is a chemical compound characterized by its unique structure, which includes a tetrahydro-pyran ring fused with a cycloheptyl group and an amine functional group. This compound typically exhibits properties associated with both cyclic amines and saturated heterocycles, such as moderate polarity and potential for hydrogen bonding due to the presence of the amine group. The cycloheptyl moiety contributes to its hydrophobic characteristics, influencing its solubility in organic solvents. The compound may also display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Additionally, the presence of the tetrahydropyran ring may impart stability and influence the compound's reactivity. Overall, N-Cycloheptyltetrahydro-2H-pyran-4-amine represents a versatile scaffold for further chemical modifications and applications in various fields, including organic synthesis and pharmaceutical research.
Formula:C12H23NO
InChI:InChI=1S/C12H23NO/c1-2-4-6-11(5-3-1)13-12-7-9-14-10-8-12/h11-13H,1-10H2
InChI key:InChIKey=JCBOOGSXSYKLBO-UHFFFAOYSA-N
SMILES:N(C1CCCCCC1)C2CCOCC2
Synonyms:- 2H-Pyran-4-amine, N-cycloheptyltetrahydro-
- CYCLOHEPTYL-(TETRAHYDRO-PYRAN-4-YL)-AMINE
- N-Cycloheptyltetrahydro-2H-pyran-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
