
CAS 885281-07-2
:N-Cyclooctyltetrahydro-2H-pyran-4-amine
Description:
N-Cyclooctyltetrahydro-2H-pyran-4-amine is a chemical compound characterized by its unique structure, which includes a tetrahydro-2H-pyran ring and a cyclooctyl group. This compound features an amine functional group, which contributes to its potential reactivity and interactions in various chemical environments. The presence of the tetrahydropyran moiety suggests that it may exhibit properties typical of cyclic ethers, such as moderate polarity and the ability to participate in hydrogen bonding. The cyclooctyl substituent can influence the compound's steric properties and hydrophobicity, potentially affecting its solubility in organic solvents and biological systems. Additionally, the amine group may impart basicity, allowing for interactions with acids and other electrophiles. Overall, N-Cyclooctyltetrahydro-2H-pyran-4-amine's structural features suggest it could be of interest in medicinal chemistry and materials science, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C13H25NO
InChI:InChI=1S/C13H25NO/c1-2-4-6-12(7-5-3-1)14-13-8-10-15-11-9-13/h12-14H,1-11H2
InChI key:InChIKey=RSRITCOHVBUGEH-UHFFFAOYSA-N
SMILES:N(C1CCCCCCC1)C2CCOCC2
Synonyms:- 2H-Pyran-4-amine, N-cyclooctyltetrahydro-
- N-Cyclooctyltetrahydro-2H-pyran-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
