CymitQuimica logo

CAS 885281-10-7

:

1,4,5,6-Tetrahydro-2-methylpyrrolo[3,4-d]imidazole

Description:
1,4,5,6-Tetrahydro-2-methylpyrrolo[3,4-d]imidazole is a heterocyclic organic compound characterized by its bicyclic structure, which includes both a pyrrole and an imidazole ring. This compound features a tetrahydro configuration, indicating that it contains four hydrogen atoms that saturate the rings, contributing to its stability and reactivity. The presence of a methyl group at the 2-position of the pyrrolo ring influences its chemical properties, potentially affecting its solubility and reactivity. This compound is of interest in medicinal chemistry due to its potential biological activities, which may include antimicrobial or anticancer properties. Its unique structure allows for various synthetic modifications, making it a valuable scaffold in drug design. Additionally, the compound's CAS number, 885281-10-7, facilitates its identification in chemical databases and literature. Overall, 1,4,5,6-Tetrahydro-2-methylpyrrolo[3,4-d]imidazole represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C6H9N3
InChI:InChI=1S/C6H9N3/c1-4-8-5-2-7-3-6(5)9-4/h7H,2-3H2,1H3,(H,8,9)
InChI key:InChIKey=VIPJPNIEHGEJOE-UHFFFAOYSA-N
SMILES:CC=1NC2=C(N1)CNC2
Synonyms:
  • 1,4,5,6-Tetrahydro-2-methylpyrrolo[3,4-d]imidazole
  • 2-Methyl-1,4,5,6-Tetrahydro-Pyrrolo[3,4-D]Imidazole
  • 2-Methyl-1,4,5,6-tetrahydropyrrolo[3,4-d]imidazole
  • 2-Methyl-1H,4H,5H,6H-pyrrolo[3,4-d]imidazole
  • Pyrrolo[3,4-d]imidazole, 1,4,5,6-tetrahydro-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.