CAS 885281-24-3
:4-(1H-Imidazol-5-yl)benzenemethanamine
Description:
4-(1H-Imidazol-5-yl)benzenemethanamine, with the CAS number 885281-24-3, is an organic compound characterized by its structure, which features a benzene ring substituted with an imidazole group and an amine functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the amine group. The imidazole moiety contributes to its biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may participate in hydrogen bonding due to the amine and imidazole nitrogen atoms, influencing its reactivity and interactions with biological targets. Additionally, it may exhibit basic properties due to the amine group, which can accept protons. Overall, 4-(1H-Imidazol-5-yl)benzenemethanamine is a versatile compound with potential applications in drug design and development, particularly in areas targeting imidazole-related biological pathways.
Formula:C10H11N3
InChI:InChI=1S/C10H11N3/c11-5-8-1-3-9(4-2-8)10-6-12-7-13-10/h1-4,6-7H,5,11H2,(H,12,13)
InChI key:InChIKey=HGIDLCJAORUXFC-UHFFFAOYSA-N
SMILES:C(N)C1=CC=C(C=C1)C2=CN=CN2
Synonyms:- 4-(1H-Imidazol-4-yl)benzylamine
- 4-(1H-Imidazol-5-yl)benzenemethanamine
- Benzenemethanamine, 4-(1H-imidazol-4-yl)-
- Benzenemethanamine,4-(1H-imidazol-4-yl)- (9CI)
- [4-(1H-Imidazol-4-yl)phenyl]methanamine
- [4-(1H-Imidazol-5-yl)phenyl]methanamine
- Benzenemethanamine, 4-(1H-imidazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
