CAS 885281-33-4
:5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylic acid
Description:
5,6,7,8-Tetrahydroimidazo[1,2-a]pyrazine-2-carboxylic acid is a heterocyclic organic compound characterized by its bicyclic structure, which includes an imidazole and pyrazine moiety. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. It is typically a white to off-white solid and is soluble in polar solvents, which is common for compounds containing carboxylic acid groups. The presence of nitrogen atoms in its structure may impart unique properties, such as the ability to participate in hydrogen bonding and coordination with metal ions. This compound is of interest in medicinal chemistry and drug development due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its structural features may also allow for modifications that enhance its pharmacological profile. As with many heterocycles, it may exhibit interesting electronic properties, making it a candidate for further research in various chemical applications.
Formula:C7H9N3O2
InChI:InChI=1/C7H9N3O2/c11-7(12)5-4-10-2-1-8-3-6(10)9-5/h4,8H,1-3H2,(H,11,12)
SMILES:C1Cn2cc(C(=O)O)nc2CN1
Synonyms:- Imidazo[1,2-A]Pyrazine-2-Carboxylic Acid, 5,6,7,8-Tetrahydro-
- 5,6,7,8-Tetrahydroimidazo[1,2-a]pyrazine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6,7,8-Tetrahydroimidazo[1,2-a]pyrazine-2-carboxylic acid
CAS:Formula:C7H9N3O2Molecular weight:167.1653
