CAS 88529-81-1

2-[(1-Methyl-1H-pyrazol-3-yl)methoxy]-1H-isoindole-1,3(2H)-dione

Description:

2-[(1-Methyl-1H-pyrazol-3-yl)methoxy]-1H-isoindole-1,3(2H)-dione, with the CAS number 88529-81-1, is a chemical compound characterized by its complex structure, which includes an isoindole core and a pyrazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups that can participate in various chemical reactions. It may display biological activity, making it of interest in medicinal chemistry and drug development. The isoindole structure often contributes to its stability and potential interactions with biological targets. Additionally, the methyl group on the pyrazole ring can influence its electronic properties and steric hindrance, affecting its overall reactivity and interaction with other molecules. As with many organic compounds, its physical properties, such as melting point and boiling point, would depend on the specific conditions and purity of the sample. Overall, this compound represents a unique combination of structural features that may lend itself to various applications in research and industry.

Formula: C₁₃H₁₁N₃O₃

InChI: InChI=1S/C13H11N3O3/c1-15-7-6-9(14-15)8-19-16-12(17)10-4-2-3-5-11(10)13(16)18/h2-7H,8H2,1H3

InChI key: InChIKey=SEPXZJWZKZFEDU-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)N1OCC=3C=CN(C)N3)=CC=CC2

Synonyms:

• 1H-Isoindole-1,3(2H)-dione, 2-[(1-methyl-1H-pyrazol-3-yl)methoxy]-
• 2-((1-Methyl-1H-pyrazol-3-yl)methoxy)isoindoline-1,3-dione
• 2-[(1-Methyl-1H-pyrazol-3-yl)methoxy]-1H-isoindole-1,3(2H)-dione

1H-Isoindole-1,3(2H)-dione, 2-[(1-methyl-1H-pyrazol-3-yl)methoxy]-

CAS: 88529-81-1

Formula: C₁₃H₁₁N₃O₃

Molecular weight: 257.2447

Ref: IN-DA00458K