CAS 88530-32-9
:S-(Acetamidomethyl)-L-cysteinamide hydrochloride (1:1)
Description:
S-(Acetamidomethyl)-L-cysteinamide hydrochloride is a synthetic compound that belongs to the class of amino acids and derivatives. It is characterized by the presence of a cysteine backbone, which is an amino acid containing a thiol group, contributing to its reactivity and potential biological activity. The acetamidomethyl group enhances its solubility and stability, making it suitable for various biochemical applications. As a hydrochloride salt, it is typically more soluble in water than its free base form, facilitating its use in aqueous environments. This compound may exhibit properties such as antioxidant activity due to the thiol group, and it can participate in redox reactions. Its structural features allow it to interact with biological systems, potentially influencing protein synthesis and cellular processes. The compound is often utilized in research settings, particularly in studies related to biochemistry and pharmacology, where it may serve as a building block for peptide synthesis or as a reagent in chemical reactions. Proper handling and storage conditions are essential to maintain its stability and efficacy.
Formula:C6H14ClN3O2S
InChI:InChI=1S/C6H13N3O2S.ClH/c1-4(10)9-3-12-2-5(7)6(8)11;/h5H,2-3,7H2,1H3,(H2,8,11)(H,9,10);1H/t5-;/m0./s1
SMILES:CC(=NCSC[C@@H](C(=N)O)N)O.Cl
Synonyms:- H-Cys(Acm)-NH2・HCl
- H-Cys(Acm)-Nh2.Hcl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
H-Cys(Acm)-NH2.HCl
CAS:M03076 - H-Cys(Acm)-NH2.HCl
Formula:C6H14ClN3O2SColor and Shape:Solid, White powderMolecular weight:227.71


