
CAS 88536-31-6
:1-[4,6-Bis(2-propen-1-ylamino)-1,3,5-triazin-2-yl]-4-piperidinone
Description:
1-[4,6-Bis(2-propen-1-ylamino)-1,3,5-triazin-2-yl]-4-piperidinone, with the CAS number 88536-31-6, is a chemical compound that features a triazine ring substituted with piperidinone and propenylamino groups. This structure contributes to its potential applications in various fields, including agriculture and pharmaceuticals. The presence of the triazine moiety suggests that it may exhibit herbicidal or fungicidal properties, as many triazine derivatives are known for their effectiveness in these areas. The piperidinone component may enhance its biological activity and solubility in organic solvents. Additionally, the compound's multiple functional groups allow for diverse reactivity, making it a candidate for further chemical modifications. Its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound's unique structure and functional groups position it as a potentially valuable substance in research and industrial applications. However, specific safety and handling guidelines should be followed due to the presence of reactive amine groups.
Formula:C14H20N6O
InChI:InChI=1S/C14H20N6O/c1-3-7-15-12-17-13(16-8-4-2)19-14(18-12)20-9-5-11(21)6-10-20/h3-4H,1-2,5-10H2,(H2,15,16,17,18,19)
InChI key:InChIKey=FSUMHMZGCTXKMH-UHFFFAOYSA-N
SMILES:N(CC=C)C1=NC(=NC(NCC=C)=N1)N2CCC(=O)CC2
Synonyms:- 4-Piperidinone, 1-[4,6-bis(2-propenylamino)-1,3,5-triazin-2-yl]-
- 4-Piperidinone, 1-[4,6-bis(2-propen-1-ylamino)-1,3,5-triazin-2-yl]-
- 1-[4,6-Bis(2-propen-1-ylamino)-1,3,5-triazin-2-yl]-4-piperidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4,6-Bis(allylamino)-1,3,5-triazin-2-yl)piperidin-4-one
CAS:Formula:C14H20N6OMolecular weight:288.3482
