
CAS 88536-36-1
:1-[4,6-Bis(2-propen-1-ylamino)-1,3,5-triazin-2-yl]-3-piperidinone
Description:
1-[4,6-Bis(2-propen-1-ylamino)-1,3,5-triazin-2-yl]-3-piperidinone, with the CAS number 88536-36-1, is a chemical compound characterized by its complex structure that includes a triazine ring and a piperidinone moiety. The presence of multiple propenylamino groups suggests that it may exhibit significant reactivity, particularly in polymerization or cross-linking reactions. This compound is likely to be soluble in polar organic solvents due to the presence of nitrogen atoms, which can engage in hydrogen bonding. Its triazine core may impart stability and potential applications in agricultural chemistry, particularly as a herbicide or pesticide, given the triazine class's known efficacy in these areas. Additionally, the piperidinone structure may contribute to its biological activity, possibly influencing its interaction with biological targets. Overall, this compound's unique structural features suggest potential utility in various chemical applications, although specific properties such as melting point, boiling point, and reactivity would require empirical measurement for precise characterization.
Formula:C14H20N6O
InChI:InChI=1S/C14H20N6O/c1-3-7-15-12-17-13(16-8-4-2)19-14(18-12)20-9-5-6-11(21)10-20/h3-4H,1-2,5-10H2,(H2,15,16,17,18,19)
InChI key:InChIKey=YTCZSJLGRFROFB-UHFFFAOYSA-N
SMILES:N(CC=C)C1=NC(=NC(NCC=C)=N1)N2CC(=O)CCC2
Synonyms:- 1-[4,6-Bis(2-propen-1-ylamino)-1,3,5-triazin-2-yl]-3-piperidinone
- 3-Piperidinone, 1-[4,6-bis(2-propenylamino)-1,3,5-triazin-2-yl]-
- 3-Piperidinone, 1-[4,6-bis(2-propen-1-ylamino)-1,3,5-triazin-2-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4,6-Bis(allylamino)-1,3,5-triazin-2-yl)piperidin-3-one
CAS:Formula:C14H20N6OMolecular weight:288.3482
