CAS 88538-50-5

1-[4-(2-Methyl-5-nitro-1H-benzimidazol-1-yl)phenyl]ethanone

Description:

1-[4-(2-Methyl-5-nitro-1H-benzimidazol-1-yl)phenyl]ethanone, with the CAS number 88538-50-5, is a chemical compound characterized by its complex structure, which includes a benzimidazole moiety and an ethanone functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the nitro group suggests it may have electron-withdrawing characteristics, influencing its reactivity and solubility. The methyl group on the benzimidazole ring can affect its steric and electronic properties, potentially enhancing its lipophilicity. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to pharmacological activities. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Overall, this compound represents a class of organic molecules that may have applications in drug development or as intermediates in chemical synthesis.

Formula: C₁₆H₁₃N₃O₃

InChI: InChI=1S/C16H13N3O3/c1-10(20)12-3-5-13(6-4-12)18-11(2)17-15-9-14(19(21)22)7-8-16(15)18/h3-9H,1-2H3

InChI key: InChIKey=UBLJVVIPZNBAND-UHFFFAOYSA-N

SMILES: CC=1N(C=2C(N1)=CC(N(=O)=O)=CC2)C3=CC=C(C(C)=O)C=C3

Synonyms:

• 1-[4-(2-Methyl-5-nitro-1H-benzimidazol-1-yl)phenyl]ethanone
• Ethanone, 1-[4-(2-methyl-5-nitro-1H-benzimidazol-1-yl)phenyl]-

Ethanone, 1-[4-(2-methyl-5-nitro-1H-benzimidazol-1-yl)phenyl]-

CAS: 88538-50-5

Formula: C₁₆H₁₃N₃O₃

Molecular weight: 295.2927

Ref: IN-DA0046NP