CAS 88539-74-6
:Phosphine oxide, trioctyl-, hydrate (1:2)
Description:
Phosphine oxide, trioctyl-, hydrate (1:2) is an organophosphorus compound characterized by the presence of a phosphine oxide functional group and three octyl groups attached to the phosphorus atom. This compound typically appears as a colorless to pale yellow liquid and is known for its hydrophilic properties due to the presence of water molecules in its hydrate form. It exhibits moderate solubility in organic solvents and is less soluble in water. The presence of the octyl groups contributes to its hydrophobic characteristics, making it useful in various applications, including as a surfactant or emulsifier in chemical formulations. Additionally, phosphine oxides are known for their stability and can act as ligands in coordination chemistry. Safety considerations include handling it with care, as phosphine derivatives can be toxic and may pose environmental hazards. Overall, phosphine oxide, trioctyl-, hydrate (1:2) is a versatile compound with applications in industrial and research settings, particularly in the fields of materials science and organic synthesis.
Formula:C24H51OPH2O
InChI:InChI=1S/C24H51OP.2H2O/c1-4-7-10-13-16-19-22-26(25,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;;/h4-24H2,1-3H3;2*1H2
InChI key:InChIKey=XFJUEDDRLVRZMA-UHFFFAOYSA-N
SMILES:P(CCCCCCCC)(CCCCCCCC)(CCCCCCCC)=O.O
Synonyms:- Phosphine oxide, trioctyl-, hydrate (1:2)
- Phosphine oxide, trioctyl-, dihydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
