CAS 88541-08-6

1-[3-[(Triphenylphosphoranylidene)amino]phenyl]ethanone

Description:

1-[3-[(Triphenylphosphoranylidene)amino]phenyl]ethanone, with the CAS number 88541-08-6, is an organic compound characterized by its complex structure featuring a ketone functional group and a triphenylphosphoranylidene moiety. This compound typically exhibits a high degree of stability due to the resonance stabilization provided by the triphenylphosphoranylidene group, which can influence its reactivity and interactions with other chemical species. The presence of the phenyl groups contributes to its hydrophobic characteristics, while the ketone group introduces polar characteristics, allowing for potential hydrogen bonding interactions. This compound may be utilized in various applications, including organic synthesis and as a ligand in coordination chemistry. Its unique structural features may also impart interesting optical or electronic properties, making it a subject of interest in materials science and organic electronics. Overall, the compound's properties are influenced by its molecular structure, which combines both hydrophobic and polar characteristics, leading to diverse potential applications in chemistry and related fields.

Formula: C₂₆H₂₂NOP

InChI: InChI=1S/C26H22NOP/c1-21(28)22-12-11-13-23(20-22)27-29(24-14-5-2-6-15-24,25-16-7-3-8-17-25)26-18-9-4-10-19-26/h2-20H,1H3

InChI key: InChIKey=ORTXQBXWMKSULO-UHFFFAOYSA-N

SMILES: P(=NC1=CC(C(C)=O)=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4

Synonyms:

• 1-[3-[(Triphenylphosphoranylidene)amino]phenyl]ethanone
• Ethanone, 1-[3-[(triphenylphosphoranylidene)amino]phenyl]-

Ethanone, 1-[3-[(triphenylphosphoranylidene)amino]phenyl]-

CAS: 88541-08-6

Formula: C₂₆H₂₂NOP

Molecular weight: 395.4327

Ref: IN-DA004DSB