CAS 88544-02-9
:5,7,7,9,9,11,11,11-Octachloro-1-undecen-3-one
Description:
5,7,7,9,9,11,11,11-Octachloro-1-undecen-3-one, with the CAS number 88544-02-9, is a synthetic organic compound characterized by its chlorinated structure. This compound features a long carbon chain with multiple chlorine substituents, which significantly influence its chemical properties and reactivity. The presence of the carbon-carbon double bond (alkene) and a ketone functional group contributes to its unique reactivity, making it a potential candidate for various chemical applications, including as an intermediate in organic synthesis. The high degree of chlorination typically imparts increased stability and hydrophobicity, affecting its solubility in different solvents. Additionally, the compound may exhibit biological activity, which necessitates careful handling and assessment of its environmental impact. Due to its complex structure, it may also be subject to specific regulatory scrutiny regarding its use and disposal. Overall, 5,7,7,9,9,11,11,11-Octachloro-1-undecen-3-one represents a specialized chemical with potential applications in industrial chemistry and research.
Formula:C11H12Cl8O
InChI:InChI=1S/C11H12Cl8O/c1-2-8(20)3-7(12)4-9(13,14)5-10(15,16)6-11(17,18)19/h2,7H,1,3-6H2
InChI key:InChIKey=OHCFWDFYCMJAMV-UHFFFAOYSA-N
SMILES:C(C(CC(CC(C=C)=O)Cl)(Cl)Cl)C(CC(Cl)(Cl)Cl)(Cl)Cl
Synonyms:- 5,7,7,9,9,11,11,11-Octachloro-1-undecen-3-one
- 1-Undecen-3-one, 5,7,7,9,9,11,11,11-octachloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
