CymitQuimica logo

CAS 885457-18-1

:

2-Methyl-3-[(5-nitro-2-furanyl)carbonyl]-1-indolizinecarboxaldehyde

Description:
2-Methyl-3-[(5-nitro-2-furanyl)carbonyl]-1-indolizinecarboxaldehyde is a complex organic compound characterized by its unique structural features, which include an indolizine ring system, a furan moiety, and a carbonyl group. The presence of the nitro group on the furan ring contributes to its electron-withdrawing properties, potentially enhancing its reactivity in various chemical reactions. This compound is likely to exhibit significant biological activity due to its structural motifs, which are often associated with pharmacological properties. Its aldehyde functional group may also facilitate further chemical modifications or reactions, such as condensation or reduction. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 2-Methyl-3-[(5-nitro-2-furanyl)carbonyl]-1-indolizinecarboxaldehyde represents a fascinating subject for research in organic chemistry and medicinal chemistry.
Formula:C15H10N2O5
InChI:InChI=1S/C15H10N2O5/c1-9-10(8-18)11-4-2-3-7-16(11)14(9)15(19)12-5-6-13(22-12)17(20)21/h2-8H,1H3
InChI key:InChIKey=OLJDQPUMRHYUME-UHFFFAOYSA-N
SMILES:C(=O)(C=1N2C(=C(C=O)C1C)C=CC=C2)C=3OC(N(=O)=O)=CC3
Synonyms:
  • 1-Indolizinecarboxaldehyde, 2-methyl-3-[(5-nitro-2-furanyl)carbonyl]-
  • 2-Methyl-3-[(5-nitro-2-furanyl)carbonyl]-1-indolizinecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.