CAS 885458-02-6

4-[(4-Bromophenoxy)methyl]-2-thiazolamine

Description:

4-[(4-Bromophenoxy)methyl]-2-thiazolamine is an organic compound characterized by its thiazole and phenoxy functional groups. The presence of a bromine atom in the para position of the phenyl ring enhances its reactivity and may influence its biological activity. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen, contributing to its potential pharmacological properties. The amine group in the thiazole structure can participate in hydrogen bonding, affecting solubility and interaction with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique combination of functional groups may impart specific properties, such as antimicrobial or anticancer activity, although detailed biological evaluations would be necessary to confirm such effects. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions, making it essential to consider these factors in practical applications.

Formula: C₁₀H₉BrN₂OS

InChI: InChI=1S/C10H9BrN2OS/c11-7-1-3-9(4-2-7)14-5-8-6-15-10(12)13-8/h1-4,6H,5H2,(H2,12,13)

InChI key: InChIKey=NNYNANIGBBBHCO-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(Br)C=C1)C2=CSC(N)=N2

Synonyms:

• 2-Thiazolamine, 4-[(4-bromophenoxy)methyl]-
• 4-[(4-Bromophenoxy)methyl]-2-thiazolamine