
CAS 885459-09-6
:4-Chloro-N-[(4-chlorophenyl)methyl]-2-cyano-3-hydroxy-2-butenamide
Description:
4-Chloro-N-[(4-chlorophenyl)methyl]-2-cyano-3-hydroxy-2-butenamide is a synthetic organic compound characterized by its complex structure, which includes a chloro substituent, a cyano group, and a hydroxyl group. This compound features a butenamide backbone, indicating the presence of both an amide and an alkene functional group. The presence of the cyano group contributes to its potential reactivity and polarity, while the hydroxyl group enhances its solubility in polar solvents. The two chloro substituents on the phenyl rings may influence its biological activity and interaction with other molecules. This compound is of interest in medicinal chemistry and may exhibit various pharmacological properties, making it a candidate for further research in drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C12H10Cl2N2O2
InChI:InChI=1S/C12H10Cl2N2O2/c13-5-11(17)10(6-15)12(18)16-7-8-1-3-9(14)4-2-8/h1-4,17H,5,7H2,(H,16,18)
InChI key:InChIKey=FHGNBNXLWUEIHN-UHFFFAOYSA-N
SMILES:C(NC(C(=C(CCl)O)C#N)=O)C1=CC=C(Cl)C=C1
Synonyms:- 2-Butenamide, 4-chloro-N-[(4-chlorophenyl)methyl]-2-cyano-3-hydroxy-
- 4-Chloro-N-[(4-chlorophenyl)methyl]-2-cyano-3-hydroxy-2-butenamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.