CAS 885459-69-8

2-Bromo-N-methyl-α-phenylbenzenemethanamine

Description:

2-Bromo-N-methyl-α-phenylbenzenemethanamine, identified by its CAS number 885459-69-8, is a chemical compound that belongs to the class of substituted phenylamines. This substance features a bromine atom attached to the second position of a phenyl ring, along with a methyl group and an amine functional group, which contributes to its basic properties. The presence of the bromine atom can influence its reactivity and solubility, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The N-methyl group enhances its lipophilicity, which may affect its biological activity and interaction with cellular targets. As a phenylamine derivative, it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with brominated compounds. Overall, this compound's unique structure suggests it could have applications in organic synthesis and medicinal chemistry, although further research would be necessary to fully understand its properties and potential uses.

Formula: C₁₄H₁₄BrN

InChI: InChI=1S/C14H14BrN/c1-16-14(11-7-3-2-4-8-11)12-9-5-6-10-13(12)15/h2-10,14,16H,1H3

InChI key: InChIKey=HUUOWYZTEOSVSA-UHFFFAOYSA-N

SMILES: C(NC)(C1=C(Br)C=CC=C1)C2=CC=CC=C2

Synonyms:

• 2-Bromo-N-methyl-α-phenylbenzenemethanamine
• Benzenemethanamine, 2-bromo-N-methyl-α-phenyl-