CymitQuimica logo

CAS 885461-52-9

:

N-[4-(Aminosulfonyl)phenyl]-5-(chloromethyl)-1,2,4-oxadiazole-3-acetamide

Description:
N-[4-(Aminosulfonyl)phenyl]-5-(chloromethyl)-1,2,4-oxadiazole-3-acetamide is a chemical compound characterized by its complex structure, which includes an oxadiazole ring, a chloromethyl group, and an aminosulfonyl phenyl moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential reactivity due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. The aminosulfonyl group may impart specific biological activity, making it of interest in pharmaceutical research. The oxadiazole ring is known for its stability and can contribute to the compound's overall chemical resilience. Additionally, the presence of the acetamide functional group suggests potential interactions with biological targets, which could be relevant in medicinal chemistry. Overall, this compound's unique structural features may lead to diverse applications, particularly in drug development and materials science. However, specific safety and handling guidelines should be followed due to the potential hazards associated with its chemical properties.
Formula:C11H11ClN4O4S
InChI:InChI=1S/C11H11ClN4O4S/c12-6-11-15-9(16-20-11)5-10(17)14-7-1-3-8(4-2-7)21(13,18)19/h1-4H,5-6H2,(H,14,17)(H2,13,18,19)
InChI key:InChIKey=YRNYYDBNKGJLKF-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC=C(NC(CC=2N=C(CCl)ON2)=O)C=C1
Synonyms:
  • N-[4-(Aminosulfonyl)phenyl]-5-(chloromethyl)-1,2,4-oxadiazole-3-acetamide
  • 1,2,4-Oxadiazole-3-acetamide, N-[4-(aminosulfonyl)phenyl]-5-(chloromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.