CymitQuimica logo

CAS 885465-98-5

:

4-(3-Furanyl)benzaldehyde

Description:
4-(3-Furanyl)benzaldehyde, with the CAS number 885465-98-5, is an organic compound characterized by the presence of both a furan ring and a benzaldehyde functional group. This compound features a furan moiety attached to the para position of a benzaldehyde, which contributes to its unique chemical properties. It typically appears as a yellow to brown liquid or solid, depending on its purity and specific conditions. The compound is known for its aromatic characteristics, which can impart a pleasant odor, making it of interest in the fragrance and flavor industries. Additionally, 4-(3-Furanyl)benzaldehyde may exhibit biological activity, potentially serving as a precursor in the synthesis of various pharmaceuticals or agrochemicals. Its reactivity is influenced by the aldehyde group, allowing for various chemical transformations, including condensation and oxidation reactions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if inhaled or ingested.
Formula:C11H8O2
InChI:InChI=1S/C11H8O2/c12-7-9-1-3-10(4-2-9)11-5-6-13-8-11/h1-8H
InChI key:InChIKey=QUGMHBNQYXZEIU-UHFFFAOYSA-N
SMILES:C(=O)C1=CC=C(C=C1)C=2C=COC2
Synonyms:
  • 4-(3-Furanyl)benzaldehyde
  • 4-(Furan-3-yl)benzaldehyde
  • Benzaldehyde, 4-(3-furanyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.