CAS 88549-23-9
:3-(1,3-benzoxazol-2-yl)-L-alanine
Description:
3-(1,3-benzoxazol-2-yl)-L-alanine is an organic compound characterized by the presence of a benzoxazole moiety attached to the amino acid L-alanine. This compound features a benzoxazole ring, which is a bicyclic structure composed of a benzene ring fused to an oxazole ring, contributing to its unique chemical properties. The presence of the L-alanine component provides the molecule with an amino group (-NH2) and a carboxylic acid group (-COOH), characteristic of amino acids, which allows for potential interactions in biological systems. The compound may exhibit various biological activities, potentially acting as a neurotransmitter or influencing metabolic pathways due to its structural similarity to other amino acids. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the compound's CAS number, 88549-23-9, serves as a unique identifier for regulatory and research purposes, facilitating its study in fields such as medicinal chemistry and biochemistry.
Formula:C10H10N2O3
InChI:InChI=1/C10H10N2O3/c11-6(10(13)14)5-9-12-7-3-1-2-4-8(7)15-9/h1-4,6H,5,11H2,(H,13,14)/t6-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
