CAS 885498-60-2
:4-Fluoroleucine ethyl ester
Description:
4-Fluoroleucine ethyl ester is an amino acid derivative characterized by the presence of a fluorine atom at the fourth position of the leucine structure, which is an essential branched-chain amino acid. This compound is typically used in biochemical research and pharmaceutical applications due to its potential role in studying protein synthesis and enzyme activity. The ethyl ester form enhances its solubility and bioavailability, making it suitable for various experimental conditions. As a fluorinated amino acid, it may exhibit unique properties compared to its non-fluorinated counterparts, such as altered hydrophobicity and reactivity, which can influence protein folding and function. The presence of the ethyl ester group also allows for easier incorporation into peptides and proteins during synthesis. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use in laboratory settings. Overall, 4-Fluoroleucine ethyl ester serves as a valuable tool in the fields of medicinal chemistry and biochemistry.
Formula:C8H16FNO2
InChI:InChI=1S/C8H16FNO2/c1-4-12-7(11)6(10)5-8(2,3)9/h6H,4-5,10H2,1-3H3
InChI key:InChIKey=MJEBOMLXSMSDDI-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(CC(C)(C)F)N
Synonyms:- Leucine, 4-fluoro-, ethyl ester
- 4-Fluoroleucine ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.